ozan
b2aad43a44
Extensive per-track meta feeds DeepSeek planning. Caravan of the Night kept with electric guitar marked disliked. Sahara Saz remains gold standard. Gateway index.html auto-plays on tinqs.com. Co-authored-by: Cursor <cursoragent@cursor.com>
59 lines
2.3 KiB
JSON
59 lines
2.3 KiB
JSON
{
|
|
"id": "aee4994a",
|
|
"title": "Nomad's Saz",
|
|
"mood": "hypnotic desert dub with Turkish soul",
|
|
"dj_line": "From the Sahara to Anatolia — here's a caravan of warm analog dub.",
|
|
"lyria_prompt": "Instrumental track at 85 BPM, desert blues meets Anadolu psych dub. Tinariwen-style electric guitar playing a slow, hypnotic riff with heavy spring reverb and dub delay. Layered with a darbuka playing a driving but relaxed rhythm, shakers, and hand percussion. A ney flute enters with a melancholic melody. Deep sub bass pulses underneath. A baglama/saz plays a sparse, atmospheric figure. Use warm analog tape saturation, spacious reverb, and subtle echo effects. No vocals. Build slowly, with a sense of nocturnal travel across dunes.",
|
|
"lyrics": "[[A0]]\n[[B1]]\n[[C2]]\n[[B3]]\n[[D4]]\n[[E5]]",
|
|
"file": "aee4994a_Nomad_s_Saz.mp3",
|
|
"saved_at": "2026-06-07T13:56:19.182738+00:00",
|
|
"generation": {
|
|
"model": "lyria-3-pro-preview",
|
|
"vocal_mode": "instrumental",
|
|
"language": "auto"
|
|
},
|
|
"structure": {
|
|
"bpm": 85,
|
|
"duration_sec_est": 97,
|
|
"skip_intro_sec": 30,
|
|
"sections": [
|
|
{ "at_sec": 0, "label": "Intro", "notes": "BAD — thin guitar/perc loop, skip this" },
|
|
{ "at_sec": 30, "label": "Saz enters", "notes": "AMAZING — when saz kicks in the track opens up" }
|
|
]
|
|
},
|
|
"instruments_detected": [
|
|
"baglama/saz",
|
|
"ney flute",
|
|
"electric guitar",
|
|
"sub bass",
|
|
"darbuka",
|
|
"shakers"
|
|
],
|
|
"tags": ["desert-dub", "anadolu", "instrumental", "vocal-booth-cued"],
|
|
"curation": {
|
|
"rating": "keeper",
|
|
"rating_label": "saz amazing, intro bad",
|
|
"shuffle_weight": 1.0,
|
|
"public_playlist": true,
|
|
"listener": "ozan",
|
|
"rated_at": "2026-06-07",
|
|
"notes": "Intro is a bit bad — guitar/perc only too long. When saz kicks in it's amazing. User wants deep throat/chest vocal layer over the saz section (vocal booth cues at 0:30).",
|
|
"loved": [
|
|
"saz when it enters",
|
|
"ney melody",
|
|
"sub bass",
|
|
"warm analog dub"
|
|
],
|
|
"disliked": [
|
|
"thin intro",
|
|
"guitar-only opening",
|
|
"slow saz entry"
|
|
],
|
|
"avoid_in_successors": [
|
|
"long guitar-only intro before saz",
|
|
"more than 15s without saz or ney"
|
|
],
|
|
"clone_prompt_hints": "Like Nomad's Saz from 0:30 onward — saz+ney first, skip thin guitar intro. Or start with saz immediately."
|
|
}
|
|
}
|